C22H30N4O4Si — CID 67651505
[1-(4-methanehydrazonoylphenyl)-2-oxopiperidin-3-yl] 2-acetyl-2-amino-5-trimethylsilylpent-4-ynoate (PubChem CID 67651505) has the molecular formula C22H30N4O4Si and a molecular weight of 442.59 g/mol. Its IUPAC name is [1-(4-methanehydrazonoylphenyl)-2-oxopiperidin-3-yl] 2-acetyl-2-amino-5-trimethylsilylpent-4-ynoate.
| Compound Name | [1-(4-methanehydrazonoylphenyl)-2-oxopiperidin-3-yl] 2-acetyl-2-amino-5-trimethylsilylpent-4-ynoate |
|---|---|
| PubChem CID | 67651505 |
| Molecular Formula | C22H30N4O4Si |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [1-(4-methanehydrazonoylphenyl)-2-oxopiperidin-3-yl] 2-acetyl-2-amino-5-trimethylsilylpent-4-ynoate |
| SMILES | CC(=O)C(N)(CC#C[Si](C)(C)C)C(=O)OC1CCCN(c2ccc(C=NN)cc2)C1=O |
| InChI | InChI=1S/C22H30N4O4Si/c1-16(27)22(23,12-6-14-31(2,3)4)21(29)30-19-7-5-13-26(20(19)28)18-10-8-17(9-11-18)15-25-24/h8-11,15,19H,5,7,12-13,23-24H2,1-4H3 |
| InChIKey | HLKZUHIVHDJOJE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|