C24H34N4O4Si — CID 70277015
(3S)-2-ethyl-3-[[2-[1-(4-methanehydrazonoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-5-trimethylsilylpent-4-ynoic acid (PubChem CID 70277015) has the molecular formula C24H34N4O4Si and a molecular weight of 470.65 g/mol. Its IUPAC name is (3S)-2-ethyl-3-[[2-[1-(4-methanehydrazonoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-5-trimethylsilylpent-4-ynoic acid.
| Compound Name | (3S)-2-ethyl-3-[[2-[1-(4-methanehydrazonoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-5-trimethylsilylpent-4-ynoic acid |
|---|---|
| PubChem CID | 70277015 |
| Molecular Formula | C24H34N4O4Si |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (3S)-2-ethyl-3-[[2-[1-(4-methanehydrazonoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-5-trimethylsilylpent-4-ynoic acid |
| SMILES | CCC(C(=O)O)[C@@H](C#C[Si](C)(C)C)NC(=O)CC1CCCN(c2ccc(C=NN)cc2)C1=O |
| InChI | InChI=1S/C24H34N4O4Si/c1-5-20(24(31)32)21(12-14-33(2,3)4)27-22(29)15-18-7-6-13-28(23(18)30)19-10-8-17(9-11-19)16-26-25/h8-11,16,18,20-21H,5-7,13,15,25H2,1-4H3,(H,27,29)(H,31,32)/t18?,20?,21-/m1/s1 |
| InChIKey | DQNMXYIOLHEPDH-DQVLVPHSSA-N |
| XLogP | 2.59 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|