C30H46N4O2 — CID 67652386
1-[(3aS,3bR,9aR,9bR,11aS)-1-(aminomethyl)-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,8,9,9b,10,11-decahydro-2H-cyclopenta[i]phenanthridin-1-yl]-1-(1-adamantyl)urea (PubChem CID 67652386) has the molecular formula C30H46N4O2 and a molecular weight of 494.72 g/mol. Its IUPAC name is 1-[(3aS,3bR,9aR,9bR,11aS)-1-(aminomethyl)-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,8,9,9b,10,11-decahydro-2H-cyclopenta[i]phenanthridin-1-yl]-1-(1-adamantyl)urea.
| Compound Name | 1-[(3aS,3bR,9aR,9bR,11aS)-1-(aminomethyl)-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,8,9,9b,10,11-decahydro-2H-cyclopenta[i]phenanthridin-1-yl]-1-(1-adamantyl)urea |
|---|---|
| PubChem CID | 67652386 |
| Molecular Formula | C30H46N4O2 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | 1-[(3aS,3bR,9aR,9bR,11aS)-1-(aminomethyl)-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,8,9,9b,10,11-decahydro-2H-cyclopenta[i]phenanthridin-1-yl]-1-(1-adamantyl)urea |
| SMILES | C[C@]12CCC(=O)C=C1NC[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(CN)N(C(N)=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H46N4O2/c1-27-6-3-21(35)12-25(27)33-16-22-23(27)4-7-28(2)24(22)5-8-30(28,17-31)34(26(32)36)29-13-18-9-19(14-29)11-20(10-18)15-29/h12,18-20,22-24,33H,3-11,13-17,31H2,1-2H3,(H2,32,36)/t18?,19?,20?,22-,23-,24+,27-,28+,29?,30?/m1/s1 |
| InChIKey | VGGGRTZSKZVPPK-FABIDBBPSA-N |
| XLogP | 4.33 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |