C22H24O8 — CID 67652637
(3,5-dihydroxyphenyl) 2-[4-[2-(3,5-dihydroxyphenoxy)-2-oxoethyl]cyclohexyl]acetate (PubChem CID 67652637) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is (3,5-dihydroxyphenyl) 2-[4-[2-(3,5-dihydroxyphenoxy)-2-oxoethyl]cyclohexyl]acetate.
| Compound Name | (3,5-dihydroxyphenyl) 2-[4-[2-(3,5-dihydroxyphenoxy)-2-oxoethyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 67652637 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (3,5-dihydroxyphenyl) 2-[4-[2-(3,5-dihydroxyphenoxy)-2-oxoethyl]cyclohexyl]acetate |
| SMILES | O=C(CC1CCC(CC(=O)Oc2cc(O)cc(O)c2)CC1)Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C22H24O8/c23-15-7-16(24)10-19(9-15)29-21(27)5-13-1-2-14(4-3-13)6-22(28)30-20-11-17(25)8-18(26)12-20/h7-14,23-26H,1-6H2 |
| InChIKey | XOLYTVDFZCZYON-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|