About (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate
(4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate (PubChem CID 89209635) has the molecular formula C15H22N2O6
and a molecular weight of 326.35 g/mol. Its IUPAC name is (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate.
Molecular Properties
| Compound Name | (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate |
| PubChem CID | 89209635 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate |
| SMILES | O=C(CC1CCN(CCON(O)O)CC1)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C15H22N2O6/c18-13-1-3-14(4-2-13)23-15(19)11-12-5-7-16(8-6-12)9-10-22-17(20)21/h1-4,12,18,20-21H,5-11H2 |
| InChIKey | LBJVYKATSFAMRV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate?
The IUPAC name of (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate (CID 89209635) is (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate.
What is the SMILES notation for (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate?
The canonical SMILES for (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate is O=C(CC1CCN(CCON(O)O)CC1)Oc1ccc(O)cc1.
What is the InChIKey of (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate?
The InChIKey is LBJVYKATSFAMRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O6/c18-13-1-3-14(4-2-13)23-15(19)11-12-5-7-16(8-6-12)9-10-22-17(20)21/h1-4,12,18,20-21H,5-11H2.
What are the key properties of (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate?
(4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate has a molecular weight of 326.35 g/mol, XLogP of 1.41, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl) 2-[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]acetate is sourced from PubChem (CID 89209635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).