C16H24N2O7 — CID 89047696
[1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]methyl 4-hydroxy-3-methoxybenzoate (PubChem CID 89047696) has the molecular formula C16H24N2O7 and a molecular weight of 356.38 g/mol. Its IUPAC name is [1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]methyl 4-hydroxy-3-methoxybenzoate.
| Compound Name | [1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]methyl 4-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 89047696 |
| Molecular Formula | C16H24N2O7 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [1-[2-(dihydroxyamino)oxyethyl]piperidin-4-yl]methyl 4-hydroxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCC2CCN(CCON(O)O)CC2)ccc1O |
| InChI | InChI=1S/C16H24N2O7/c1-23-15-10-13(2-3-14(15)19)16(20)24-11-12-4-6-17(7-5-12)8-9-25-18(21)22/h2-3,10,12,19,21-22H,4-9,11H2,1H3 |
| InChIKey | QABVLGOJXIAECL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|