About benzylsulfanylmethyl 2-aminoacetate
benzylsulfanylmethyl 2-aminoacetate (PubChem CID 67654488) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is benzylsulfanylmethyl 2-aminoacetate.
Molecular Properties
| Compound Name | benzylsulfanylmethyl 2-aminoacetate |
| PubChem CID | 67654488 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | benzylsulfanylmethyl 2-aminoacetate |
| SMILES | NCC(=O)OCSCc1ccccc1 |
| InChI | InChI=1S/C10H13NO2S/c11-6-10(12)13-8-14-7-9-4-2-1-3-5-9/h1-5H,6-8,11H2 |
| InChIKey | COETWBTYRHYAOW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze benzylsulfanylmethyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylsulfanylmethyl 2-aminoacetate?
The IUPAC name of benzylsulfanylmethyl 2-aminoacetate (CID 67654488) is benzylsulfanylmethyl 2-aminoacetate.
What is the SMILES notation for benzylsulfanylmethyl 2-aminoacetate?
The canonical SMILES for benzylsulfanylmethyl 2-aminoacetate is NCC(=O)OCSCc1ccccc1.
What is the InChIKey of benzylsulfanylmethyl 2-aminoacetate?
The InChIKey is COETWBTYRHYAOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c11-6-10(12)13-8-14-7-9-4-2-1-3-5-9/h1-5H,6-8,11H2.
What are the key properties of benzylsulfanylmethyl 2-aminoacetate?
benzylsulfanylmethyl 2-aminoacetate has a molecular weight of 211.29 g/mol, XLogP of 1.38, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzylsulfanylmethyl 2-aminoacetate is sourced from PubChem (CID 67654488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).