C22H30N2O3 — CID 67656743
benzyl N-[(2R)-3-amino-7-hydroxy-2-methyl-7-phenylheptyl]carbamate (PubChem CID 67656743) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is benzyl N-[(2R)-3-amino-7-hydroxy-2-methyl-7-phenylheptyl]carbamate.
| Compound Name | benzyl N-[(2R)-3-amino-7-hydroxy-2-methyl-7-phenylheptyl]carbamate |
|---|---|
| PubChem CID | 67656743 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | benzyl N-[(2R)-3-amino-7-hydroxy-2-methyl-7-phenylheptyl]carbamate |
| SMILES | C[C@H](CNC(=O)OCc1ccccc1)C(N)CCCC(O)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O3/c1-17(15-24-22(26)27-16-18-9-4-2-5-10-18)20(23)13-8-14-21(25)19-11-6-3-7-12-19/h2-7,9-12,17,20-21,25H,8,13-16,23H2,1H3,(H,24,26)/t17-,20?,21?/m1/s1 |
| InChIKey | UTWKLRIMYVSGFE-MDMXATFFSA-N |
| XLogP | 3.78 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |