C26H50O3Si — CID 67659029
pentan-3-yl (4S)-4-[(1R,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoate (PubChem CID 67659029) has the molecular formula C26H50O3Si and a molecular weight of 438.77 g/mol. Its IUPAC name is pentan-3-yl (4S)-4-[(1R,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoate.
| Compound Name | pentan-3-yl (4S)-4-[(1R,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoate |
|---|---|
| PubChem CID | 67659029 |
| Molecular Formula | C26H50O3Si |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | pentan-3-yl (4S)-4-[(1R,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoate |
| SMILES | CCC(CC)OC(=O)CC[C@H](C)[C@H]1CC[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C26H50O3Si/c1-10-20(11-2)28-24(27)17-14-19(3)21-15-16-22-23(13-12-18-26(21,22)7)29-30(8,9)25(4,5)6/h19-23H,10-18H2,1-9H3/t19-,21+,22-,23+,26+/m0/s1 |
| InChIKey | ZUTGABFULWYWCE-CJXPHRMXSA-N |
| XLogP | 7.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|