C21H17ClN2O2 — CID 67659151
4-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 67659151) has the molecular formula C21H17ClN2O2 and a molecular weight of 364.83 g/mol. Its IUPAC name is 4-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 67659151 |
| Molecular Formula | C21H17ClN2O2 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 4-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(CCc2cc(Cl)ccc2OCc2ccccc2)cc[nH]c1=O |
| InChI | InChI=1S/C21H17ClN2O2/c22-18-8-9-20(26-14-15-4-2-1-3-5-15)17(12-18)7-6-16-10-11-24-21(25)19(16)13-23/h1-5,8-12H,6-7,14H2,(H,24,25) |
| InChIKey | PEWNSVXBZXRFOE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |