C21H18ClN5O2 — CID 54309672
6-[5-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]tetrazol-2-yl]-1H-pyridin-2-one (PubChem CID 54309672) has the molecular formula C21H18ClN5O2 and a molecular weight of 407.86 g/mol. Its IUPAC name is 6-[5-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]tetrazol-2-yl]-1H-pyridin-2-one.
| Compound Name | 6-[5-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]tetrazol-2-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 54309672 |
| Molecular Formula | C21H18ClN5O2 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 6-[5-[2-(5-chloro-2-phenylmethoxyphenyl)ethyl]tetrazol-2-yl]-1H-pyridin-2-one |
| SMILES | O=c1cccc(-n2nnc(CCc3cc(Cl)ccc3OCc3ccccc3)n2)[nH]1 |
| InChI | InChI=1S/C21H18ClN5O2/c22-17-10-11-18(29-14-15-5-2-1-3-6-15)16(13-17)9-12-19-24-26-27(25-19)20-7-4-8-21(28)23-20/h1-8,10-11,13H,9,12,14H2,(H,23,28) |
| InChIKey | SJZYMMHAUNRSPZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |