C38H44N2O4 — CID 67659421
2-benzamido-2-[4-[bis(4-propylphenyl)methylamino]-2,3-dimethylphenoxy]butanoic acid (PubChem CID 67659421) has the molecular formula C38H44N2O4 and a molecular weight of 592.78 g/mol. Its IUPAC name is 2-benzamido-2-[4-[bis(4-propylphenyl)methylamino]-2,3-dimethylphenoxy]butanoic acid.
| Compound Name | 2-benzamido-2-[4-[bis(4-propylphenyl)methylamino]-2,3-dimethylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 67659421 |
| Molecular Formula | C38H44N2O4 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | 2-benzamido-2-[4-[bis(4-propylphenyl)methylamino]-2,3-dimethylphenoxy]butanoic acid |
| SMILES | CCCc1ccc(C(Nc2ccc(OC(CC)(NC(=O)c3ccccc3)C(=O)O)c(C)c2C)c2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C38H44N2O4/c1-6-12-28-16-20-30(21-17-28)35(31-22-18-29(13-7-2)19-23-31)39-33-24-25-34(27(5)26(33)4)44-38(8-3,37(42)43)40-36(41)32-14-10-9-11-15-32/h9-11,14-25,35,39H,6-8,12-13H2,1-5H3,(H,40,41)(H,42,43) |
| InChIKey | JQSYBTUBNNCBJJ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|