C31H37NO5 — CID 67659099
2-benzamido-2-[2,3-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenoxy]butanoic acid (PubChem CID 67659099) has the molecular formula C31H37NO5 and a molecular weight of 503.64 g/mol. Its IUPAC name is 2-benzamido-2-[2,3-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenoxy]butanoic acid.
| Compound Name | 2-benzamido-2-[2,3-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67659099 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 2-benzamido-2-[2,3-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenoxy]butanoic acid |
| SMILES | CCC(NC(=O)c1ccccc1)(Oc1ccc(OC(C)c2ccc(CC(C)C)cc2)c(C)c1C)C(=O)O |
| InChI | InChI=1S/C31H37NO5/c1-7-31(30(34)35,32-29(33)26-11-9-8-10-12-26)37-28-18-17-27(21(4)22(28)5)36-23(6)25-15-13-24(14-16-25)19-20(2)3/h8-18,20,23H,7,19H2,1-6H3,(H,32,33)(H,34,35) |
| InChIKey | KAHLGYUCRSMFKS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|