C26H25N3O5 — CID 67663809
N-[2-(3,4-dimethoxyphenyl)-1H-indol-3-yl]-2-(4-nitrophenyl)butanamide (PubChem CID 67663809) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-1H-indol-3-yl]-2-(4-nitrophenyl)butanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-1H-indol-3-yl]-2-(4-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 67663809 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-1H-indol-3-yl]-2-(4-nitrophenyl)butanamide |
| SMILES | CCC(C(=O)Nc1c(-c2ccc(OC)c(OC)c2)[nH]c2ccccc12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H25N3O5/c1-4-19(16-9-12-18(13-10-16)29(31)32)26(30)28-25-20-7-5-6-8-21(20)27-24(25)17-11-14-22(33-2)23(15-17)34-3/h5-15,19,27H,4H2,1-3H3,(H,28,30) |
| InChIKey | CPKNBJFMJGQCGH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|