C33H27N5O5 — CID 67665899
5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-bis[2-(2-methoxyphenyl)ethynyl]-4-oxo-1,2-dihydroquinoline-3-carboxylic acid (PubChem CID 67665899) has the molecular formula C33H27N5O5 and a molecular weight of 573.61 g/mol. Its IUPAC name is 5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-bis[2-(2-methoxyphenyl)ethynyl]-4-oxo-1,2-dihydroquinoline-3-carboxylic acid.
| Compound Name | 5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-bis[2-(2-methoxyphenyl)ethynyl]-4-oxo-1,2-dihydroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67665899 |
| Molecular Formula | C33H27N5O5 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-bis[2-(2-methoxyphenyl)ethynyl]-4-oxo-1,2-dihydroquinoline-3-carboxylic acid |
| SMILES | COc1ccccc1C#CC1Nc2cccc(Cc3cnc(N)nc3N)c2C(=O)C1(C#Cc1ccccc1OC)C(=O)O |
| InChI | InChI=1S/C33H27N5O5/c1-42-25-12-5-3-8-20(25)14-15-27-33(31(40)41,17-16-21-9-4-6-13-26(21)43-2)29(39)28-22(10-7-11-24(28)37-27)18-23-19-36-32(35)38-30(23)34/h3-13,19,27,37H,18H2,1-2H3,(H,40,41)(H4,34,35,36,38) |
| InChIKey | BQPLRKGCCURIGS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|