C37H39N5O5 — CID 67667485
ethyl 1-(1-adamantyl)-5-[(2,4-diaminopyrimidin-5-yl)methyl]-7-[2-(2,3-dimethoxyphenyl)ethynyl]-4-oxoquinoline-3-carboxylate (PubChem CID 67667485) has the molecular formula C37H39N5O5 and a molecular weight of 633.75 g/mol. Its IUPAC name is ethyl 1-(1-adamantyl)-5-[(2,4-diaminopyrimidin-5-yl)methyl]-7-[2-(2,3-dimethoxyphenyl)ethynyl]-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-(1-adamantyl)-5-[(2,4-diaminopyrimidin-5-yl)methyl]-7-[2-(2,3-dimethoxyphenyl)ethynyl]-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 67667485 |
| Molecular Formula | C37H39N5O5 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | ethyl 1-(1-adamantyl)-5-[(2,4-diaminopyrimidin-5-yl)methyl]-7-[2-(2,3-dimethoxyphenyl)ethynyl]-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C23CC4CC(CC(C4)C2)C3)c2cc(C#Cc3cccc(OC)c3OC)cc(Cc3cnc(N)nc3N)c2c1=O |
| InChI | InChI=1S/C37H39N5O5/c1-4-47-35(44)28-20-42(37-16-22-10-23(17-37)12-24(11-22)18-37)29-14-21(8-9-25-6-5-7-30(45-2)33(25)46-3)13-26(31(29)32(28)43)15-27-19-40-36(39)41-34(27)38/h5-7,13-14,19-20,22-24H,4,10-12,15-18H2,1-3H3,(H4,38,39,40,41) |
| InChIKey | SHSCUQFNYFEEEG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 144.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|