C11H16Cl2N2O2 — CID 67666969
(2S)-2-[2-(4-chlorophenyl)ethylamino]-3-hydroxypropanamide;hydrochloride (PubChem CID 67666969) has the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.17 g/mol. Its IUPAC name is (2S)-2-[2-(4-chlorophenyl)ethylamino]-3-hydroxypropanamide;hydrochloride.
| Compound Name | (2S)-2-[2-(4-chlorophenyl)ethylamino]-3-hydroxypropanamide;hydrochloride |
|---|---|
| PubChem CID | 67666969 |
| Molecular Formula | C11H16Cl2N2O2 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (2S)-2-[2-(4-chlorophenyl)ethylamino]-3-hydroxypropanamide;hydrochloride |
| SMILES | Cl.NC(=O)[C@H](CO)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H15ClN2O2.ClH/c12-9-3-1-8(2-4-9)5-6-14-10(7-15)11(13)16;/h1-4,10,14-15H,5-7H2,(H2,13,16);1H/t10-;/m0./s1 |
| InChIKey | QVAHVLWTQPJAJD-PPHPATTJSA-N |
| XLogP | 0.74 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |