C30H46O3 — CID 67668802
(3R,4R,7S,13S,16R,17R)-3,4,10,10,17,21,21-heptamethyl-23-oxahexacyclo[18.2.1.03,16.04,13.07,12.017,22]tricos-11-ene-7-carboxylic acid (PubChem CID 67668802) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is (3R,4R,7S,13S,16R,17R)-3,4,10,10,17,21,21-heptamethyl-23-oxahexacyclo[18.2.1.03,16.04,13.07,12.017,22]tricos-11-ene-7-carboxylic acid.
| Compound Name | (3R,4R,7S,13S,16R,17R)-3,4,10,10,17,21,21-heptamethyl-23-oxahexacyclo[18.2.1.03,16.04,13.07,12.017,22]tricos-11-ene-7-carboxylic acid |
|---|---|
| PubChem CID | 67668802 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | (3R,4R,7S,13S,16R,17R)-3,4,10,10,17,21,21-heptamethyl-23-oxahexacyclo[18.2.1.03,16.04,13.07,12.017,22]tricos-11-ene-7-carboxylic acid |
| SMILES | CC1(C)C=C2[C@H]3CC[C@@H]4[C@@]5(C)CCC6OC(C[C@@]4(C)[C@]3(C)CC[C@@]2(C(=O)O)CC1)C5C6(C)C |
| InChI | InChI=1S/C30H46O3/c1-25(2)12-14-30(24(31)32)15-13-28(6)18(19(30)16-25)8-9-21-27(5)11-10-22-26(3,4)23(27)20(33-22)17-29(21,28)7/h16,18,20-23H,8-15,17H2,1-7H3,(H,31,32)/t18-,20?,21-,22?,23?,27-,28-,29-,30+/m1/s1 |
| InChIKey | RRROTBRWMYOXKF-KKCCRXKZSA-N |
| XLogP | 7.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|