C20H28O4 — CID 67669720
ethyl 1-acetyl-4-methoxy-2-(2,4,6-trimethylphenyl)cyclopentane-1-carboxylate (PubChem CID 67669720) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is ethyl 1-acetyl-4-methoxy-2-(2,4,6-trimethylphenyl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-acetyl-4-methoxy-2-(2,4,6-trimethylphenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 67669720 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | ethyl 1-acetyl-4-methoxy-2-(2,4,6-trimethylphenyl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(C)=O)CC(OC)CC1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C20H28O4/c1-7-24-19(22)20(15(5)21)11-16(23-6)10-17(20)18-13(3)8-12(2)9-14(18)4/h8-9,16-17H,7,10-11H2,1-6H3 |
| InChIKey | MTPYHIFDWDLQTA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|