C19H26O3 — CID 18977488
1-acetyl-4-methyl-2-(2,4,6-trimethylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 18977488) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 1-acetyl-4-methyl-2-(2,4,6-trimethylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-acetyl-4-methyl-2-(2,4,6-trimethylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 18977488 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1-acetyl-4-methyl-2-(2,4,6-trimethylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(=O)C1(C(=O)O)CCC(C)CC1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C19H26O3/c1-11-6-7-19(15(5)20,18(21)22)16(10-11)17-13(3)8-12(2)9-14(17)4/h8-9,11,16H,6-7,10H2,1-5H3,(H,21,22) |
| InChIKey | ASMGWBYAXUEQIT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|