C19H26N4O2 — CID 67672093
1-[(2S)-butan-2-yl]-N-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)indazole-3-carboxamide (PubChem CID 67672093) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-N-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)indazole-3-carboxamide.
| Compound Name | 1-[(2S)-butan-2-yl]-N-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 67672093 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-N-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)indazole-3-carboxamide |
| SMILES | CC[C@H](C)n1nc(C(=O)NC2CC3COCC(C2)N3)c2ccccc21 |
| InChI | InChI=1S/C19H26N4O2/c1-3-12(2)23-17-7-5-4-6-16(17)18(22-23)19(24)21-13-8-14-10-25-11-15(9-13)20-14/h4-7,12-15,20H,3,8-11H2,1-2H3,(H,21,24)/t12-,13?,14?,15?/m0/s1 |
| InChIKey | RNEACAAJJMKMJH-NAOUJUTFSA-N |
| XLogP | 2.26 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |