C17H20ClNO2 — CID 67673760
2-[(1R,2R)-2-amino-4-(2-chlorophenyl)-1-hydroxy-3-methylbutyl]phenol (PubChem CID 67673760) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 2-[(1R,2R)-2-amino-4-(2-chlorophenyl)-1-hydroxy-3-methylbutyl]phenol.
| Compound Name | 2-[(1R,2R)-2-amino-4-(2-chlorophenyl)-1-hydroxy-3-methylbutyl]phenol |
|---|---|
| PubChem CID | 67673760 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[(1R,2R)-2-amino-4-(2-chlorophenyl)-1-hydroxy-3-methylbutyl]phenol |
| SMILES | CC(Cc1ccccc1Cl)[C@@H](N)[C@H](O)c1ccccc1O |
| InChI | InChI=1S/C17H20ClNO2/c1-11(10-12-6-2-4-8-14(12)18)16(19)17(21)13-7-3-5-9-15(13)20/h2-9,11,16-17,20-21H,10,19H2,1H3/t11?,16-,17-/m1/s1 |
| InChIKey | MHJVOEGKEVTTAR-YSGDOOFJSA-N |
| XLogP | 3.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |