C22H34O4 — CID 67673856
(2S,3R)-2-[(4R,5R)-4-methoxy-5-phenylmethoxynon-1-en-2-yl]oxan-3-ol (PubChem CID 67673856) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (2S,3R)-2-[(4R,5R)-4-methoxy-5-phenylmethoxynon-1-en-2-yl]oxan-3-ol.
| Compound Name | (2S,3R)-2-[(4R,5R)-4-methoxy-5-phenylmethoxynon-1-en-2-yl]oxan-3-ol |
|---|---|
| PubChem CID | 67673856 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (2S,3R)-2-[(4R,5R)-4-methoxy-5-phenylmethoxynon-1-en-2-yl]oxan-3-ol |
| SMILES | C=C(C[C@@H](OC)[C@@H](CCCC)OCc1ccccc1)[C@@H]1OCCC[C@H]1O |
| InChI | InChI=1S/C22H34O4/c1-4-5-13-20(26-16-18-10-7-6-8-11-18)21(24-3)15-17(2)22-19(23)12-9-14-25-22/h6-8,10-11,19-23H,2,4-5,9,12-16H2,1,3H3/t19-,20-,21-,22+/m1/s1 |
| InChIKey | HPRUXDWQFRDJMS-YSFYHYPLSA-N |
| XLogP | 4.26 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|