C17H22O3 — CID 72702193
(2R,3S)-2-[(2R)-2-phenylmethoxypenta-3,4-dienyl]oxan-3-ol (PubChem CID 72702193) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2R,3S)-2-[(2R)-2-phenylmethoxypenta-3,4-dienyl]oxan-3-ol.
| Compound Name | (2R,3S)-2-[(2R)-2-phenylmethoxypenta-3,4-dienyl]oxan-3-ol |
|---|---|
| PubChem CID | 72702193 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2R,3S)-2-[(2R)-2-phenylmethoxypenta-3,4-dienyl]oxan-3-ol |
| SMILES | C=C=C[C@@H](C[C@H]1OCCC[C@@H]1O)OCc1ccccc1 |
| InChI | InChI=1S/C17H22O3/c1-2-7-15(12-17-16(18)10-6-11-19-17)20-13-14-8-4-3-5-9-14/h3-5,7-9,15-18H,1,6,10-13H2/t15-,16-,17+/m0/s1 |
| InChIKey | DCKVQOYVOWEYLP-YESZJQIVSA-N |
| XLogP | 2.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |