C31H48N2O3 — CID 67675100
1-adamantyl N-[(1S,3aS,3bS,4S,5aR,9aR,9bS,11aS)-4,6,9a,11a-tetramethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]carbamate (PubChem CID 67675100) has the molecular formula C31H48N2O3 and a molecular weight of 496.74 g/mol. Its IUPAC name is 1-adamantyl N-[(1S,3aS,3bS,4S,5aR,9aR,9bS,11aS)-4,6,9a,11a-tetramethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]carbamate.
| Compound Name | 1-adamantyl N-[(1S,3aS,3bS,4S,5aR,9aR,9bS,11aS)-4,6,9a,11a-tetramethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]carbamate |
|---|---|
| PubChem CID | 67675100 |
| Molecular Formula | C31H48N2O3 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.37 |
| IUPAC Name | 1-adamantyl N-[(1S,3aS,3bS,4S,5aR,9aR,9bS,11aS)-4,6,9a,11a-tetramethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]carbamate |
| SMILES | C[C@H]1C[C@H]2N(C)C(=O)CC[C@]2(C)[C@H]2CC[C@]3(C)[C@@H](NC(=O)OC45CC6CC(CC(C6)C4)C5)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C31H48N2O3/c1-18-11-25-30(3,10-8-26(34)33(25)4)23-7-9-29(2)22(27(18)23)5-6-24(29)32-28(35)36-31-15-19-12-20(16-31)14-21(13-19)17-31/h18-25,27H,5-17H2,1-4H3,(H,32,35)/t18-,19?,20?,21?,22-,23-,24-,25+,27-,29-,30+,31?/m0/s1 |
| InChIKey | IUNJBJXWJURGOU-IZPZFEMRSA-N |
| XLogP | 6.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |