C20H25NO4P+ — CID 67676337
[2-(5-benzylmorpholin-2-yl)-1-(4-methoxyphenyl)ethyl]-hydroxy-oxophosphanium (PubChem CID 67676337) has the molecular formula C20H25NO4P+ and a molecular weight of 374.40 g/mol. Its IUPAC name is [2-(5-benzylmorpholin-2-yl)-1-(4-methoxyphenyl)ethyl]-hydroxy-oxophosphanium.
| Compound Name | [2-(5-benzylmorpholin-2-yl)-1-(4-methoxyphenyl)ethyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67676337 |
| Molecular Formula | C20H25NO4P+ |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [2-(5-benzylmorpholin-2-yl)-1-(4-methoxyphenyl)ethyl]-hydroxy-oxophosphanium |
| SMILES | COc1ccc(C(CC2CNC(Cc3ccccc3)CO2)[P+](=O)O)cc1 |
| InChI | InChI=1S/C20H24NO4P/c1-24-18-9-7-16(8-10-18)20(26(22)23)12-19-13-21-17(14-25-19)11-15-5-3-2-4-6-15/h2-10,17,19-21H,11-14H2,1H3/p+1 |
| InChIKey | HIJJYCBHIBOVDT-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|