C19H26N2O3 — CID 67683025
6-tert-butyl-4-oxo-2-(pentylamino)chromene-3-carboxamide (PubChem CID 67683025) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 6-tert-butyl-4-oxo-2-(pentylamino)chromene-3-carboxamide.
| Compound Name | 6-tert-butyl-4-oxo-2-(pentylamino)chromene-3-carboxamide |
|---|---|
| PubChem CID | 67683025 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 6-tert-butyl-4-oxo-2-(pentylamino)chromene-3-carboxamide |
| SMILES | CCCCCNc1oc2ccc(C(C)(C)C)cc2c(=O)c1C(N)=O |
| InChI | InChI=1S/C19H26N2O3/c1-5-6-7-10-21-18-15(17(20)23)16(22)13-11-12(19(2,3)4)8-9-14(13)24-18/h8-9,11,21H,5-7,10H2,1-4H3,(H2,20,23) |
| InChIKey | YWZIKHCMSHSAPZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|