C18H25N3O4 — CID 67684684
(3S)-3-amino-4-oxo-4-[[(2S)-1-oxo-1-(1-phenylbut-3-enylamino)butan-2-yl]amino]butanoic acid (PubChem CID 67684684) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is (3S)-3-amino-4-oxo-4-[[(2S)-1-oxo-1-(1-phenylbut-3-enylamino)butan-2-yl]amino]butanoic acid.
| Compound Name | (3S)-3-amino-4-oxo-4-[[(2S)-1-oxo-1-(1-phenylbut-3-enylamino)butan-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 67684684 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (3S)-3-amino-4-oxo-4-[[(2S)-1-oxo-1-(1-phenylbut-3-enylamino)butan-2-yl]amino]butanoic acid |
| SMILES | C=CCC(NC(=O)[C@H](CC)NC(=O)[C@@H](N)CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H25N3O4/c1-3-8-15(12-9-6-5-7-10-12)21-18(25)14(4-2)20-17(24)13(19)11-16(22)23/h3,5-7,9-10,13-15H,1,4,8,11,19H2,2H3,(H,20,24)(H,21,25)(H,22,23)/t13-,14-,15?/m0/s1 |
| InChIKey | MOCYIIQDZWWUSP-ZYOSVBKOSA-N |
| XLogP | 1.12 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|