C7H6O5 — CID 67685106
2H-pyran-5,6-dicarboxylic acid (PubChem CID 67685106) has the molecular formula C7H6O5 and a molecular weight of 170.12 g/mol. Its IUPAC name is 2H-pyran-5,6-dicarboxylic acid.
| Compound Name | 2H-pyran-5,6-dicarboxylic acid |
|---|---|
| PubChem CID | 67685106 |
| Molecular Formula | C7H6O5 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 2H-pyran-5,6-dicarboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)O)OCC=C1 |
| InChI | InChI=1S/C7H6O5/c8-6(9)4-2-1-3-12-5(4)7(10)11/h1-2H,3H2,(H,8,9)(H,10,11) |
| InChIKey | HUQLYIXNYHVIRD-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |