C38H44O6 — CID 67687417
[(3R,3aS,6S,6aS)-6-[4-[4-(4-pentylcyclohexyl)phenyl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methylbenzoate (PubChem CID 67687417) has the molecular formula C38H44O6 and a molecular weight of 596.76 g/mol. Its IUPAC name is [(3R,3aS,6S,6aS)-6-[4-[4-(4-pentylcyclohexyl)phenyl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methylbenzoate.
| Compound Name | [(3R,3aS,6S,6aS)-6-[4-[4-(4-pentylcyclohexyl)phenyl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 67687417 |
| Molecular Formula | C38H44O6 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | [(3R,3aS,6S,6aS)-6-[4-[4-(4-pentylcyclohexyl)phenyl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methylbenzoate |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(C(=O)O[C@H]4CO[C@@H]5[C@H]4OC[C@H]5OC(=O)c4ccc(C)cc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C38H44O6/c1-3-4-5-6-26-9-13-27(14-10-26)28-15-17-29(18-16-28)30-19-21-32(22-20-30)38(40)44-34-24-42-35-33(23-41-36(34)35)43-37(39)31-11-7-25(2)8-12-31/h7-8,11-12,15-22,26-27,33-36H,3-6,9-10,13-14,23-24H2,1-2H3/t26?,27?,33-,34+,35+,36+/m1/s1 |
| InChIKey | PNIOJQLDSDDEKD-ORVGAPNQSA-N |
| XLogP | 8.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|