C16H16O4 — CID 67688388
3,4-dimethyl-4-phenylcyclohexa-2,5-diene-1,1-dicarboxylic acid (PubChem CID 67688388) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3,4-dimethyl-4-phenylcyclohexa-2,5-diene-1,1-dicarboxylic acid.
| Compound Name | 3,4-dimethyl-4-phenylcyclohexa-2,5-diene-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 67688388 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3,4-dimethyl-4-phenylcyclohexa-2,5-diene-1,1-dicarboxylic acid |
| SMILES | CC1=CC(C(=O)O)(C(=O)O)C=CC1(C)c1ccccc1 |
| InChI | InChI=1S/C16H16O4/c1-11-10-16(13(17)18,14(19)20)9-8-15(11,2)12-6-4-3-5-7-12/h3-10H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | PGOAMOTYIQXXCU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|