C20H28N4O4 — CID 67689689
1,3-dimethyl-6-[3-[2-(2-nitrophenyl)ethyl-propylamino]propyl]pyrimidine-2,4-dione (PubChem CID 67689689) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1,3-dimethyl-6-[3-[2-(2-nitrophenyl)ethyl-propylamino]propyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[3-[2-(2-nitrophenyl)ethyl-propylamino]propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67689689 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 1,3-dimethyl-6-[3-[2-(2-nitrophenyl)ethyl-propylamino]propyl]pyrimidine-2,4-dione |
| SMILES | CCCN(CCCc1cc(=O)n(C)c(=O)n1C)CCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H28N4O4/c1-4-12-23(14-11-16-8-5-6-10-18(16)24(27)28)13-7-9-17-15-19(25)22(3)20(26)21(17)2/h5-6,8,10,15H,4,7,9,11-14H2,1-3H3 |
| InChIKey | IJJLJBNRJZTWFS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 90.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|