C33H48Br2N6O6 — CID 175476908
1,3-bis[5-[ethyl-[(2-nitrophenyl)methyl]amino]pentyl]-6-methylpyrimidine-2,4-dione;dihydrobromide (PubChem CID 175476908) has the molecular formula C33H48Br2N6O6 and a molecular weight of 784.59 g/mol. Its IUPAC name is 1,3-bis[5-[ethyl-[(2-nitrophenyl)methyl]amino]pentyl]-6-methylpyrimidine-2,4-dione;dihydrobromide.
| Compound Name | 1,3-bis[5-[ethyl-[(2-nitrophenyl)methyl]amino]pentyl]-6-methylpyrimidine-2,4-dione;dihydrobromide |
|---|---|
| PubChem CID | 175476908 |
| Molecular Formula | C33H48Br2N6O6 |
| Molecular Weight | 784.59 g/mol |
| Exact Mass | 782.20 |
| IUPAC Name | 1,3-bis[5-[ethyl-[(2-nitrophenyl)methyl]amino]pentyl]-6-methylpyrimidine-2,4-dione;dihydrobromide |
| SMILES | Br.Br.CCN(CCCCCn1c(C)cc(=O)n(CCCCCN(CC)Cc2ccccc2[N+](=O)[O-])c1=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H46N6O6.2BrH/c1-4-34(25-28-16-8-10-18-30(28)38(42)43)20-12-6-14-22-36-27(3)24-32(40)37(33(36)41)23-15-7-13-21-35(5-2)26-29-17-9-11-19-31(29)39(44)45;;/h8-11,16-19,24H,4-7,12-15,20-23,25-26H2,1-3H3;2*1H |
| InChIKey | MNHYHLLPSNNOJO-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 136.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|