C17H24N4O4 — CID 15503118
1-[5-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)pentyl]-3,6-dimethylpyrimidine-2,4-dione (PubChem CID 15503118) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[5-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)pentyl]-3,6-dimethylpyrimidine-2,4-dione.
| Compound Name | 1-[5-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)pentyl]-3,6-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15503118 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[5-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)pentyl]-3,6-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)n(C)c(=O)n1CCCCCn1c(C)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C17H24N4O4/c1-12-10-14(22)18(3)16(24)20(12)8-6-5-7-9-21-13(2)11-15(23)19(4)17(21)25/h10-11H,5-9H2,1-4H3 |
| InChIKey | MZTPIIUKTHHDHI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 88.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|