C20H28N4O5 — CID 67689754
6-[3-[2-methoxyethyl-[2-(4-nitrophenyl)ethyl]amino]propyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 67689754) has the molecular formula C20H28N4O5 and a molecular weight of 404.47 g/mol. Its IUPAC name is 6-[3-[2-methoxyethyl-[2-(4-nitrophenyl)ethyl]amino]propyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[3-[2-methoxyethyl-[2-(4-nitrophenyl)ethyl]amino]propyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67689754 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 6-[3-[2-methoxyethyl-[2-(4-nitrophenyl)ethyl]amino]propyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | COCCN(CCCc1cc(=O)n(C)c(=O)n1C)CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H28N4O5/c1-21-18(15-19(25)22(2)20(21)26)5-4-11-23(13-14-29-3)12-10-16-6-8-17(9-7-16)24(27)28/h6-9,15H,4-5,10-14H2,1-3H3 |
| InChIKey | FRWCAJITCWTAKT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 99.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|