C21H32N4O2 — CID 67689734
6-[3-[3-(4-aminophenyl)propyl-propylamino]propyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 67689734) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 6-[3-[3-(4-aminophenyl)propyl-propylamino]propyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[3-[3-(4-aminophenyl)propyl-propylamino]propyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67689734 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 6-[3-[3-(4-aminophenyl)propyl-propylamino]propyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CCCN(CCCc1ccc(N)cc1)CCCc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C21H32N4O2/c1-4-13-25(14-5-7-17-9-11-18(22)12-10-17)15-6-8-19-16-20(26)24(3)21(27)23(19)2/h9-12,16H,4-8,13-15,22H2,1-3H3 |
| InChIKey | WGLJKPXMWOLUNX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|