C21H26N6O6 — CID 67838880
methyl 2-[2-[(5-cyano-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]ethyl-[3-(4-nitrophenyl)propyl]amino]acetate (PubChem CID 67838880) has the molecular formula C21H26N6O6 and a molecular weight of 458.48 g/mol. Its IUPAC name is methyl 2-[2-[(5-cyano-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]ethyl-[3-(4-nitrophenyl)propyl]amino]acetate.
| Compound Name | methyl 2-[2-[(5-cyano-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]ethyl-[3-(4-nitrophenyl)propyl]amino]acetate |
|---|---|
| PubChem CID | 67838880 |
| Molecular Formula | C21H26N6O6 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | methyl 2-[2-[(5-cyano-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]ethyl-[3-(4-nitrophenyl)propyl]amino]acetate |
| SMILES | COC(=O)CN(CCCc1ccc([N+](=O)[O-])cc1)CCNc1c(C#N)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C21H26N6O6/c1-24-19(17(13-22)20(29)25(2)21(24)30)23-10-12-26(14-18(28)33-3)11-4-5-15-6-8-16(9-7-15)27(31)32/h6-9,23H,4-5,10-12,14H2,1-3H3 |
| InChIKey | DQPLHYNZKUTVEW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|