C27H33N5O7 — CID 70364409
2-[2-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]ethyl-[3-(4-nitrophenyl)propyl]amino]ethyl 4-methoxybenzoate (PubChem CID 70364409) has the molecular formula C27H33N5O7 and a molecular weight of 539.59 g/mol. Its IUPAC name is 2-[2-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]ethyl-[3-(4-nitrophenyl)propyl]amino]ethyl 4-methoxybenzoate.
| Compound Name | 2-[2-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]ethyl-[3-(4-nitrophenyl)propyl]amino]ethyl 4-methoxybenzoate |
|---|---|
| PubChem CID | 70364409 |
| Molecular Formula | C27H33N5O7 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2-[2-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]ethyl-[3-(4-nitrophenyl)propyl]amino]ethyl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCN(CCCc2ccc([N+](=O)[O-])cc2)CCNc2cc(=O)n(C)c(=O)n2C)cc1 |
| InChI | InChI=1S/C27H33N5O7/c1-29-24(19-25(33)30(2)27(29)35)28-14-16-31(15-4-5-20-6-10-22(11-7-20)32(36)37)17-18-39-26(34)21-8-12-23(38-3)13-9-21/h6-13,19,28H,4-5,14-18H2,1-3H3 |
| InChIKey | ZKZQPOUHSSGFIW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 137.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|