C23H34N6O8 — CID 70364472
6-[2-[2-(dimethylamino)ethyl-[3-(4-nitrophenyl)propyl]amino]ethylamino]-1,3-dimethylpyrimidine-2,4-dione;oxalic acid (PubChem CID 70364472) has the molecular formula C23H34N6O8 and a molecular weight of 522.56 g/mol. Its IUPAC name is 6-[2-[2-(dimethylamino)ethyl-[3-(4-nitrophenyl)propyl]amino]ethylamino]-1,3-dimethylpyrimidine-2,4-dione;oxalic acid.
| Compound Name | 6-[2-[2-(dimethylamino)ethyl-[3-(4-nitrophenyl)propyl]amino]ethylamino]-1,3-dimethylpyrimidine-2,4-dione;oxalic acid |
|---|---|
| PubChem CID | 70364472 |
| Molecular Formula | C23H34N6O8 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 6-[2-[2-(dimethylamino)ethyl-[3-(4-nitrophenyl)propyl]amino]ethylamino]-1,3-dimethylpyrimidine-2,4-dione;oxalic acid |
| SMILES | CN(C)CCN(CCCc1ccc([N+](=O)[O-])cc1)CCNc1cc(=O)n(C)c(=O)n1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H32N6O4.C2H2O4/c1-23(2)14-15-26(12-5-6-17-7-9-18(10-8-17)27(30)31)13-11-22-19-16-20(28)25(4)21(29)24(19)3;3-1(4)2(5)6/h7-10,16,22H,5-6,11-15H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | QQFPUFQUHOZUKV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 180.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|