C16H21N5O5 — CID 139643552
1,3-dimethyl-6-[2-[2-(4-nitrophenoxy)ethylamino]ethylamino]pyrimidine-2,4-dione (PubChem CID 139643552) has the molecular formula C16H21N5O5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 1,3-dimethyl-6-[2-[2-(4-nitrophenoxy)ethylamino]ethylamino]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[2-[2-(4-nitrophenoxy)ethylamino]ethylamino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139643552 |
| Molecular Formula | C16H21N5O5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1,3-dimethyl-6-[2-[2-(4-nitrophenoxy)ethylamino]ethylamino]pyrimidine-2,4-dione |
| SMILES | Cn1c(NCCNCCOc2ccc([N+](=O)[O-])cc2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C16H21N5O5/c1-19-14(11-15(22)20(2)16(19)23)18-8-7-17-9-10-26-13-5-3-12(4-6-13)21(24)25/h3-6,11,17-18H,7-10H2,1-2H3 |
| InChIKey | CRFRYQBKGPZFBI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|