C16H28CuN6O4 — CID 67689985
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(3-methylimidazol-4-yl)propanoyl]amino]hexanoic acid;copper (PubChem CID 67689985) has the molecular formula C16H28CuN6O4 and a molecular weight of 431.98 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(3-methylimidazol-4-yl)propanoyl]amino]hexanoic acid;copper.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(3-methylimidazol-4-yl)propanoyl]amino]hexanoic acid;copper |
|---|---|
| PubChem CID | 67689985 |
| Molecular Formula | C16H28CuN6O4 |
| Molecular Weight | 431.98 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(3-methylimidazol-4-yl)propanoyl]amino]hexanoic acid;copper |
| SMILES | C[C@H](N)C(=O)N[C@@H](Cc1cncn1C)C(=O)N[C@@H](CCCCN)C(=O)O.[Cu] |
| InChI | InChI=1S/C16H28N6O4.Cu/c1-10(18)14(23)21-13(7-11-8-19-9-22(11)2)15(24)20-12(16(25)26)5-3-4-6-17;/h8-10,12-13H,3-7,17-18H2,1-2H3,(H,20,24)(H,21,23)(H,25,26);/t10-,12-,13-;/m0./s1 |
| InChIKey | AATVZUBNPBRVRE-VHJJOGJUSA-N |
| XLogP | -1.51 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.98 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|