C24H17ClN2O2 — CID 67690386
7-chloro-4-hydroxy-3-[3-(1H-indol-2-ylmethyl)phenyl]-1H-quinolin-2-one (PubChem CID 67690386) has the molecular formula C24H17ClN2O2 and a molecular weight of 400.87 g/mol. Its IUPAC name is 7-chloro-4-hydroxy-3-[3-(1H-indol-2-ylmethyl)phenyl]-1H-quinolin-2-one.
| Compound Name | 7-chloro-4-hydroxy-3-[3-(1H-indol-2-ylmethyl)phenyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 67690386 |
| Molecular Formula | C24H17ClN2O2 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 7-chloro-4-hydroxy-3-[3-(1H-indol-2-ylmethyl)phenyl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2cc(Cl)ccc2c(O)c1-c1cccc(Cc2cc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C24H17ClN2O2/c25-17-8-9-19-21(13-17)27-24(29)22(23(19)28)16-6-3-4-14(10-16)11-18-12-15-5-1-2-7-20(15)26-18/h1-10,12-13,26H,11H2,(H2,27,28,29) |
| InChIKey | GQMRUXPFLAWIHQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |