C18H14ClNO3S — CID 57130394
7-chloro-4-hydroxy-3-(3-phenyl-2-sulfanylpropanoyl)-1H-quinolin-2-one (PubChem CID 57130394) has the molecular formula C18H14ClNO3S and a molecular weight of 359.83 g/mol. Its IUPAC name is 7-chloro-4-hydroxy-3-(3-phenyl-2-sulfanylpropanoyl)-1H-quinolin-2-one.
| Compound Name | 7-chloro-4-hydroxy-3-(3-phenyl-2-sulfanylpropanoyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 57130394 |
| Molecular Formula | C18H14ClNO3S |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 7-chloro-4-hydroxy-3-(3-phenyl-2-sulfanylpropanoyl)-1H-quinolin-2-one |
| SMILES | O=C(c1c(O)c2ccc(Cl)cc2[nH]c1=O)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C18H14ClNO3S/c19-11-6-7-12-13(9-11)20-18(23)15(16(12)21)17(22)14(24)8-10-4-2-1-3-5-10/h1-7,9,14,24H,8H2,(H2,20,21,23) |
| InChIKey | UMNYAEVOHYFEQT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|