C17H24N2O6 — CID 67692636
tert-butyl (2R)-2-(2-methoxy-5-nitrophenoxy)-2-pyrrolidin-2-ylacetate (PubChem CID 67692636) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is tert-butyl (2R)-2-(2-methoxy-5-nitrophenoxy)-2-pyrrolidin-2-ylacetate.
| Compound Name | tert-butyl (2R)-2-(2-methoxy-5-nitrophenoxy)-2-pyrrolidin-2-ylacetate |
|---|---|
| PubChem CID | 67692636 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | tert-butyl (2R)-2-(2-methoxy-5-nitrophenoxy)-2-pyrrolidin-2-ylacetate |
| SMILES | COc1ccc([N+](=O)[O-])cc1O[C@@H](C(=O)OC(C)(C)C)C1CCCN1 |
| InChI | InChI=1S/C17H24N2O6/c1-17(2,3)25-16(20)15(12-6-5-9-18-12)24-14-10-11(19(21)22)7-8-13(14)23-4/h7-8,10,12,15,18H,5-6,9H2,1-4H3/t12?,15-/m1/s1 |
| InChIKey | SQBLMPIZWYVUDQ-WPZCJLIBSA-N |
| XLogP | 2.44 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|