C25H31BrO5 — CID 67694780
methyl 3-[[2-(8-bromo-2-methoxycarbonyloctyl)phenoxy]methyl]benzoate (PubChem CID 67694780) has the molecular formula C25H31BrO5 and a molecular weight of 491.42 g/mol. Its IUPAC name is methyl 3-[[2-(8-bromo-2-methoxycarbonyloctyl)phenoxy]methyl]benzoate.
| Compound Name | methyl 3-[[2-(8-bromo-2-methoxycarbonyloctyl)phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 67694780 |
| Molecular Formula | C25H31BrO5 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | methyl 3-[[2-(8-bromo-2-methoxycarbonyloctyl)phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1cccc(COc2ccccc2CC(CCCCCCBr)C(=O)OC)c1 |
| InChI | InChI=1S/C25H31BrO5/c1-29-24(27)21-13-9-10-19(16-21)18-31-23-14-7-6-11-20(23)17-22(25(28)30-2)12-5-3-4-8-15-26/h6-7,9-11,13-14,16,22H,3-5,8,12,15,17-18H2,1-2H3 |
| InChIKey | MKSUUYKCSOPKEZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|