C10H16O4 — CID 67696240
4-(1,3-dioxolan-4-yl)-3,3-dimethyl-2-methylidenebutanoic acid (PubChem CID 67696240) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 4-(1,3-dioxolan-4-yl)-3,3-dimethyl-2-methylidenebutanoic acid.
| Compound Name | 4-(1,3-dioxolan-4-yl)-3,3-dimethyl-2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 67696240 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-(1,3-dioxolan-4-yl)-3,3-dimethyl-2-methylidenebutanoic acid |
| SMILES | C=C(C(=O)O)C(C)(C)CC1COCO1 |
| InChI | InChI=1S/C10H16O4/c1-7(9(11)12)10(2,3)4-8-5-13-6-14-8/h8H,1,4-6H2,2-3H3,(H,11,12) |
| InChIKey | USCIMUKTEVOPDD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|