C7H16BrNO2 — CID 23273521
1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide (PubChem CID 23273521) has the molecular formula C7H16BrNO2 and a molecular weight of 226.11 g/mol. Its IUPAC name is 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide.
| Compound Name | 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide |
|---|---|
| PubChem CID | 23273521 |
| Molecular Formula | C7H16BrNO2 |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide |
| SMILES | C[N+](C)(C)CC1COCO1.[Br-] |
| InChI | InChI=1S/C7H16NO2.BrH/c1-8(2,3)4-7-5-9-6-10-7;/h7H,4-6H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LHBIQROYKGITOU-UHFFFAOYSA-M |
| XLogP | -2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|