1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide

C7H16BrNO2 — CID 23273521

IUPAC1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide
SMILESC[N+](C)(C)CC1COCO1.[Br-]
InChIInChI=1S/C7H16NO2.BrH/c1-8(2,3)4-7-5-9-6-10-7;/h7H,4-6H2,1-3H3;1H/q+1;/p-1
InChIKeyLHBIQROYKGITOU-UHFFFAOYSA-M
MW226.11 g/mol
LogP-2.93
Rot. Bonds2

About 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide

1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide (PubChem CID 23273521) has the molecular formula C7H16BrNO2 and a molecular weight of 226.11 g/mol. Its IUPAC name is 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide.

Molecular Properties

Compound Name1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide
PubChem CID23273521
Molecular FormulaC7H16BrNO2
Molecular Weight226.11 g/mol
Exact Mass225.04
IUPAC Name1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide
SMILESC[N+](C)(C)CC1COCO1.[Br-]
InChIInChI=1S/C7H16NO2.BrH/c1-8(2,3)4-7-5-9-6-10-7;/h7H,4-6H2,1-3H3;1H/q+1;/p-1
InChIKeyLHBIQROYKGITOU-UHFFFAOYSA-M
XLogP-2.93
TPSA18.46 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.11
LogP ≤ 5-2.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide?
The IUPAC name of 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide (CID 23273521) is 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide.
What is the SMILES notation for 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide?
The canonical SMILES for 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide is C[N+](C)(C)CC1COCO1.[Br-].
What is the InChIKey of 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide?
The InChIKey is LHBIQROYKGITOU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16NO2.BrH/c1-8(2,3)4-7-5-9-6-10-7;/h7H,4-6H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide?
1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide has a molecular weight of 226.11 g/mol, XLogP of -2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxolan-4-ylmethyl(trimethyl)azanium bromide is sourced from PubChem (CID 23273521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).