About 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol
1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol (PubChem CID 163856921) has the molecular formula C7H12O2S
and a molecular weight of 160.24 g/mol. Its IUPAC name is 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol.
Molecular Properties
| Compound Name | 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol |
| PubChem CID | 163856921 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol |
| SMILES | SC1(C[C@@H]2COCO2)CC1 |
| InChI | InChI=1S/C7H12O2S/c10-7(1-2-7)3-6-4-8-5-9-6/h6,10H,1-5H2/t6-/m1/s1 |
| InChIKey | OZBXMCLBDUPDAR-ZCFIWIBFSA-N |
| XLogP | 1.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol?
The IUPAC name of 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol (CID 163856921) is 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol.
What is the SMILES notation for 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol?
The canonical SMILES for 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol is SC1(C[C@@H]2COCO2)CC1.
What is the InChIKey of 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol?
The InChIKey is OZBXMCLBDUPDAR-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H12O2S/c10-7(1-2-7)3-6-4-8-5-9-6/h6,10H,1-5H2/t6-/m1/s1.
What are the key properties of 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol?
1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol has a molecular weight of 160.24 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(4R)-1,3-dioxolan-4-yl]methyl]cyclopropane-1-thiol is sourced from PubChem (CID 163856921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).