C5H11N3O2 — CID 159103052
2-(1,3-dioxolan-4-ylmethyl)guanidine (PubChem CID 159103052) has the molecular formula C5H11N3O2 and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-(1,3-dioxolan-4-ylmethyl)guanidine.
| Compound Name | 2-(1,3-dioxolan-4-ylmethyl)guanidine |
|---|---|
| PubChem CID | 159103052 |
| Molecular Formula | C5H11N3O2 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-(1,3-dioxolan-4-ylmethyl)guanidine |
| SMILES | NC(N)=NCC1COCO1 |
| InChI | InChI=1S/C5H11N3O2/c6-5(7)8-1-4-2-9-3-10-4/h4H,1-3H2,(H4,6,7,8) |
| InChIKey | XYZLPPJTRJPPLS-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|