C7H15N5O2 — CID 83036120
1-(diaminomethylidene)-2-(1,4-dioxan-2-ylmethyl)guanidine (PubChem CID 83036120) has the molecular formula C7H15N5O2 and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(1,4-dioxan-2-ylmethyl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(1,4-dioxan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 83036120 |
| Molecular Formula | C7H15N5O2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-(diaminomethylidene)-2-(1,4-dioxan-2-ylmethyl)guanidine |
| SMILES | NC(N)=N/C(N)=N/CC1COCCO1 |
| InChI | InChI=1S/C7H15N5O2/c8-6(9)12-7(10)11-3-5-4-13-1-2-14-5/h5H,1-4H2,(H6,8,9,10,11,12) |
| InChIKey | GVYKJZUYGDGUSY-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|